3-Bromo-7-nitroindole structure
|
Common Name | 3-Bromo-7-nitroindole | ||
|---|---|---|---|---|
| CAS Number | 397864-11-8 | Molecular Weight | 241.04100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Bromo-7-nitroindole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5BrN2O2 |
|---|---|
| Molecular Weight | 241.04100 |
| Exact Mass | 239.95300 |
| PSA | 61.61000 |
| LogP | 3.36180 |
| InChIKey | ZJCDMQUXOJHHBJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c(Br)c[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~70%
3-Bromo-7-nitro... CAS#:397864-11-8 |
| Literature: ELI LILLY AND COMPANY Patent: WO2004/67529 A1, 2004 ; Location in patent: Page 76 ; WO 2004/067529 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-bromo-7-nitro-1H-indole |