Mebanazine sulfate
Modify Date: 2026-06-27 09:35:38
Mebanazine sulfate structure
|
Common Name | Mebanazine sulfate | ||
|---|---|---|---|---|
| CAS Number | 3979-76-8 | Molecular Weight | 234.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Mebanazine sulfate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14N2O4S |
|---|---|
| Molecular Weight | 234.28 |
| InChIKey | XTODHAAOYCGVIW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N[NH3+].OS(=O)(=O)[O-] |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 245, Current Page 1 of 25
1
2
3
4
5
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 3979-76-8? |
| A: Chinese name of 3979-76-8 is 3979-76-8. |
| Q: What is the molecular formula of Mebanazine sulfate? |
| A: Molecular formula of Mebanazine sulfate is C8H14N2O4S. |
| Q: What is the molecular weight of Mebanazine sulfate? |
| A: Molecular weight of Mebanazine sulfate is 234.28. |
| Q: What is the SMILES notation of Mebanazine sulfate? |
| A: SMILES notation of Mebanazine sulfate is CC(C1=CC=CC=C1)N[NH3+].OS(=O)(=O)[O-]. |
| Q: What is the InChIKey of Mebanazine sulfate? |
| A: InChIKey of Mebanazine sulfate is XTODHAAOYCGVIW-UHFFFAOYSA-N. |
| Q: What is the CAS number of Mebanazine sulfate? |
| A: CAS number of Mebanazine sulfate is 3979-76-8. |
| Q: What is the English name of Mebanazine sulfate? |
| A: The English name of Mebanazine sulfate is Mebanazine sulfate. |