4(1H)-Pyrimidinone, 5-(4-chlorophenyl)-6-hydroxy
4(1H)-Pyrimidinone, 5-(4-chlorophenyl)-6-hydroxy structure
|
Common Name | 4(1H)-Pyrimidinone, 5-(4-chlorophenyl)-6-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 3979-80-4 | Molecular Weight | 222.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7ClN2O2 |
|---|---|
| Molecular Weight | 222.62800 |
| Exact Mass | 222.02000 |
| PSA | 65.98000 |
| LogP | 1.79590 |
| InChIKey | AZCIUNXJXVOJGZ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cnc(O)c1-c1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 1 | |
CAS#:3974-18-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-(4-chloro-phenyl)-1H-pyrimidine-4,6-dione |
| 4,6-Dihydroxy-5-(4-chlorphenyl)-pyrimidin |
| 4(1H)-Pyrimidinone,5-(4-chlorophenyl)-6-hydroxy |
| 5-(4-chlorophenyl)-pyrimidine-4,6-diol |
| 4,6-Dihydroxy-5-(p-chlor-phenyl)-pyrimidin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: InChIKey of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one is AZCIUNXJXVOJGZ-UHFFFAOYSA-N. |
| Q: What English synonyms does 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one have? |
| A: English synonyms of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one: 5-(4-chloro-phenyl)-1H-pyrimidine-4,6-dione, 4,6-Dihydroxy-5-(4-chlorphenyl)-pyrimidin, 4(1H)-Pyrimidinone,5-(4-chlorophenyl)-6-hydroxy, 5-(4-chlorophenyl)-pyrimidine-4,6-diol, 4,6-Dihydroxy-5-(p-chlor-phenyl)-pyrimidin. |
| Q: What is the LogP of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: LogP of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one is 1.79590. |
| Q: What is the CAS number of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: CAS number of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one is 3979-80-4. |
| Q: What is the SMILES notation of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: SMILES notation of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one is O=c1[nH]cnc(O)c1-c1ccc(Cl)cc1. |
| Q: What is the molecular formula of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: Molecular formula of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one is C10H7ClN2O2. |
| Q: What are the downstream products of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: Related downstream products(CAS) of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one: 3974-18-3. |
| Q: What are the upstream materials of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: Related upstream materials(CAS) of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one: 34402-92-1;6313-33-3;1878-66-6;52449-43-1. |
| Q: What is the molecular weight of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: Molecular weight of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one is 222.62800. |
| Q: What is the English name of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one? |
| A: The English name of 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one is 5-(4-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |