Phenylalanine,2-fluoro-N-(trifluoroacetyl)- (9CI) structure
|
Common Name | Phenylalanine,2-fluoro-N-(trifluoroacetyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 39801-61-1 | Molecular Weight | 279.18800 | |
| Density | 1.444g/cm3 | Boiling Point | 397ºC at 760mmHg | |
| Molecular Formula | C11H9F4NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9ºC | |
| Name | 3-(2-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 397ºC at 760mmHg |
| Molecular Formula | C11H9F4NO3 |
| Molecular Weight | 279.18800 |
| Flash Point | 193.9ºC |
| Exact Mass | 279.05200 |
| PSA | 66.40000 |
| LogP | 1.89080 |
| Index of Refraction | 1.483 |
| InChIKey | GECHDGGPINJYTJ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1ccccc1F)NC(=O)C(F)(F)F |
|
~%
Phenylalanine,2... CAS#:39801-61-1 |
| Literature: Otani; Briley Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 4 p. 496 - 499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| o-Fluor-DL-phenylalanin-N-trifluoracetat |
| N-Trifluoracetyl-o-fluorphenylalanin |