2,2,2-trichloro-N,N-bis(3-nitrophenyl)ethane-1,1-diamine structure
|
Common Name | 2,2,2-trichloro-N,N-bis(3-nitrophenyl)ethane-1,1-diamine | ||
|---|---|---|---|---|
| CAS Number | 39809-81-9 | Molecular Weight | 405.62100 | |
| Density | 1.638g/cm3 | Boiling Point | 606.9ºC at 760 mmHg | |
| Molecular Formula | C14H11Cl3N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.9ºC | |
| Name | 2,2,2-trichloro-1-N,1-N'-bis(3-nitrophenyl)ethane-1,1-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.638g/cm3 |
|---|---|
| Boiling Point | 606.9ºC at 760 mmHg |
| Molecular Formula | C14H11Cl3N4O4 |
| Molecular Weight | 405.62100 |
| Flash Point | 320.9ºC |
| Exact Mass | 403.98500 |
| PSA | 115.70000 |
| LogP | 5.91570 |
| Index of Refraction | 1.715 |
| InChIKey | DJLVKUWYCSXXAI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(NC(Nc2cccc([N+](=O)[O-])c2)C(Cl)(Cl)Cl)c1 |
|
~%
2,2,2-trichloro... CAS#:39809-81-9 |
| Literature: Wheeler; Weller Journal of the American Chemical Society, 1902 , vol. 24, p. 1063 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| 2,2,2-Trichlor-N,N'-bis-(3-nitro-phenyl)-aethylidendiamin |
| 2,2,2-trichloro-N,N'-bis-(3-nitro-phenyl)-ethylidenediamine |