trimethyl-[2-(methylcarbamoyloxy)phenyl]azanium,iodide structure
|
Common Name | trimethyl-[2-(methylcarbamoyloxy)phenyl]azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 3983-38-8 | Molecular Weight | 336.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[2-(methylcarbamoyloxy)phenyl]azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17IN2O2 |
|---|---|
| Molecular Weight | 336.16900 |
| Exact Mass | 336.03300 |
| PSA | 44.65000 |
| LogP | 2.67660 |
| InChIKey | LIBLMNWPIQGGAO-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1ccccc1[N+](C)(C)C.[I-] |
|
~%
trimethyl-[2-(m... CAS#:3983-38-8 |
| Literature: Stedman Biochemical Journal, 1926 , vol. 20, p. 721 |
| tri-N-methyl-2-methylcarbamoyloxy-anilinium,iodide |
| Carbamic acid,N-methyl-,2-dimethylaminophenyl ester methiodide |
| Methiodide of N-methylurethane of 2-dimethylaminophenol |
| Tri-N-methyl-2-methylcarbamoyloxy-anilinium,Jodid |