benzenesulfonate,tetraethylazanium
benzenesulfonate,tetraethylazanium structure
|
Common Name | benzenesulfonate,tetraethylazanium | ||
|---|---|---|---|---|
| CAS Number | 3983-90-2 | Molecular Weight | 287.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzenesulfonate,tetraethylazanium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25NO3S |
|---|---|
| Molecular Weight | 287.41800 |
| Exact Mass | 287.15600 |
| PSA | 65.58000 |
| LogP | 3.55430 |
| InChIKey | XCMBPJMFGGKIOB-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:108-98-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethanaminium,N,N,N-triethyl-,benzenesulfonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of benzenesulfonate,tetraethylazanium? |
| A: InChIKey of benzenesulfonate,tetraethylazanium is XCMBPJMFGGKIOB-UHFFFAOYSA-M. |
| Q: What is the polar surface area (PSA) of benzenesulfonate,tetraethylazanium? |
| A: Polar surface area (PSA) of benzenesulfonate,tetraethylazanium is 65.58000. |
| Q: What is the SMILES notation of benzenesulfonate,tetraethylazanium? |
| A: SMILES notation of benzenesulfonate,tetraethylazanium is CC[N+](CC)(CC)CC.O=S(=O)([O-])c1ccccc1. |
| Q: What is the English name of benzenesulfonate,tetraethylazanium? |
| A: The English name of benzenesulfonate,tetraethylazanium is benzenesulfonate,tetraethylazanium. |
| Q: What is the CAS number of benzenesulfonate,tetraethylazanium? |
| A: CAS number of benzenesulfonate,tetraethylazanium is 3983-90-2. |
| Q: What is the molecular formula of benzenesulfonate,tetraethylazanium? |
| A: Molecular formula of benzenesulfonate,tetraethylazanium is C14H25NO3S. |
| Q: What are the downstream products of benzenesulfonate,tetraethylazanium? |
| A: Related downstream products(CAS) of benzenesulfonate,tetraethylazanium: 108-98-5. |
| Q: What is the Chinese name of 3983-90-2? |
| A: Chinese name of 3983-90-2 is 3983-90-2. |
| Q: What is the molecular weight of benzenesulfonate,tetraethylazanium? |
| A: Molecular weight of benzenesulfonate,tetraethylazanium is 287.41800. |
| Q: What English synonyms does benzenesulfonate,tetraethylazanium have? |
| A: English synonyms of benzenesulfonate,tetraethylazanium: Ethanaminium,N,N,N-triethyl-,benzenesulfonate. |