N,N-dicyclohexyl-4-methylbenzenesulfonamide structure
|
Common Name | N,N-dicyclohexyl-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 39830-56-3 | Molecular Weight | 335.50400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H29NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-dicyclohexyl-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H29NO2S |
|---|---|
| Molecular Weight | 335.50400 |
| Exact Mass | 335.19200 |
| PSA | 45.76000 |
| LogP | 5.73190 |
| InChIKey | YHJPIJPOCNSTMT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C2CCCCC2)C2CCCCC2)cc1 |
|
~82%
N,N-dicyclohexy... CAS#:39830-56-3 |
| Literature: Reddy, M. B. Madhusudana; Pasha Phosphorus, Sulfur and Silicon and the Related Elements, 2011 , vol. 186, # 9 p. 1867 - 1875 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N,N-Dicyclohexyl-toluol-4-sulfonamid |
| N,N-dicyclohexyl-p-toluenesulfonamide |
| N,N-dicyclohexyl-toluene-4-sulfonamide |
| p-Toluolsulfonsaeure-dicyclohexylamid |
| N-tosyldicyclohexylamine |
| p-Toluolsulfonyl-dicyclohexylamin |
| Benzenesulfonamide,N,N-dicyclohexyl-4-methyl |