Benzoic acid,4-[[(2-thioxo-3(2H)-benzothiazolyl)methyl]amino]- structure
|
Common Name | Benzoic acid,4-[[(2-thioxo-3(2H)-benzothiazolyl)methyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 39883-83-5 | Molecular Weight | 316.39800 | |
| Density | 1.52g/cm3 | Boiling Point | 579.6ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.3ºC | |
| Name | 4-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 579.6ºC at 760 mmHg |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.39800 |
| Flash Point | 304.3ºC |
| Exact Mass | 316.03400 |
| PSA | 114.59000 |
| LogP | 4.27310 |
| Index of Refraction | 1.786 |
| InChIKey | DKDLNTQSYSQOAY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NCn2c(=S)sc3ccccc32)cc1 |
| HS Code | 2934200090 |
|---|
|
~%
Benzoic acid,4-... CAS#:39883-83-5 |
| Literature: Varma,R.S. Journal fuer Praktische Chemie (Leipzig), 1972 , vol. 314, p. 955 - 957 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzoic acid,4-[[(2-thioxo-3(2h)-benzothiazolyl)methyl]amino] |
| 4-[(2-thioxo-benzothiazol-3-ylmethyl)-amino]-benzoic acid |