Aceticacid, 2-(2-fluoro-4-nitrophenoxy)- structure
|
Common Name | Aceticacid, 2-(2-fluoro-4-nitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 399-45-1 | Molecular Weight | 215.13500 | |
| Density | 1.529g/cm3 | Boiling Point | 410.7ºC at 760 mmHg | |
| Molecular Formula | C8H6FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.2ºC | |
| Name | 2-(2-fluoro-4-nitrophenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.529g/cm3 |
|---|---|
| Boiling Point | 410.7ºC at 760 mmHg |
| Molecular Formula | C8H6FNO5 |
| Molecular Weight | 215.13500 |
| Flash Point | 202.2ºC |
| Exact Mass | 215.02300 |
| PSA | 92.35000 |
| LogP | 1.72050 |
| Index of Refraction | 1.562 |
| InChIKey | GTFPUPQBBURCHR-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc([N+](=O)[O-])cc1F |
|
~%
Aceticacid, 2-(... CAS#:399-45-1 |
| Literature: Finger et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 94,95, 97 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2-fluoro-4-nitrophenoxy)acetic acid |
| Aceticacid,2-(2-fluoro-4-nitrophenoxy) |
| (2-Fluor-4-nitro-phenoxy)-essigsaeure |