Aceticacid, 2-(2-fluoro-4-nitrophenoxy)
Aceticacid, 2-(2-fluoro-4-nitrophenoxy) structure
|
Common Name | Aceticacid, 2-(2-fluoro-4-nitrophenoxy) | ||
|---|---|---|---|---|
| CAS Number | 399-45-1 | Molecular Weight | 215.13500 | |
| Density | 1.529g/cm3 | Boiling Point | 410.7ºC at 760 mmHg | |
| Molecular Formula | C8H6FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-fluoro-4-nitrophenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.529g/cm3 |
|---|---|
| Boiling Point | 410.7ºC at 760 mmHg |
| Molecular Formula | C8H6FNO5 |
| Molecular Weight | 215.13500 |
| Flash Point | 202.2ºC |
| Exact Mass | 215.02300 |
| PSA | 92.35000 |
| LogP | 1.72050 |
| Index of Refraction | 1.562 |
| InChIKey | GTFPUPQBBURCHR-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc([N+](=O)[O-])cc1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Aceticacid, 2-(... CAS#:399-45-1 |
| Literature: Finger et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 94,95, 97 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2-fluoro-4-nitrophenoxy)acetic acid |
| Aceticacid,2-(2-fluoro-4-nitrophenoxy) |
| (2-Fluor-4-nitro-phenoxy)-essigsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: The English name of 2-(2-fluoro-4-nitrophenoxy)acetic acid is 2-(2-fluoro-4-nitrophenoxy)acetic acid. |
| Q: What is the CAS number of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: CAS number of 2-(2-fluoro-4-nitrophenoxy)acetic acid is 399-45-1. |
| Q: What are the upstream materials of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: Related upstream materials(CAS) of 2-(2-fluoro-4-nitrophenoxy)acetic acid: 348-10-7. |
| Q: What English synonyms does 2-(2-fluoro-4-nitrophenoxy)acetic acid have? |
| A: English synonyms of 2-(2-fluoro-4-nitrophenoxy)acetic acid: (2-fluoro-4-nitrophenoxy)acetic acid, Aceticacid,2-(2-fluoro-4-nitrophenoxy), (2-Fluor-4-nitro-phenoxy)-essigsaeure. |
| Q: What is the boiling point of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: Boiling point of 2-(2-fluoro-4-nitrophenoxy)acetic acid is 410.7ºC at 760 mmHg. |
| Q: What is the SMILES notation of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: SMILES notation of 2-(2-fluoro-4-nitrophenoxy)acetic acid is O=C(O)COc1ccc([N+](=O)[O-])cc1F. |
| Q: What is the InChIKey of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: InChIKey of 2-(2-fluoro-4-nitrophenoxy)acetic acid is GTFPUPQBBURCHR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 399-45-1? |
| A: Chinese name of 399-45-1 is 399-45-1. |
| Q: What is the molecular weight of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: Molecular weight of 2-(2-fluoro-4-nitrophenoxy)acetic acid is 215.13500. |
| Q: What is the molecular formula of 2-(2-fluoro-4-nitrophenoxy)acetic acid? |
| A: Molecular formula of 2-(2-fluoro-4-nitrophenoxy)acetic acid is C8H6FNO5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |