2,5-BIS(TRIFLUOROMETHYL)-1H-BENZIMIDAZOLE structure
|
Common Name | 2,5-BIS(TRIFLUOROMETHYL)-1H-BENZIMIDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 399-69-9 | Molecular Weight | 254.13200 | |
| Density | 1.567g/cm3 | Boiling Point | 270.1ºC at 760 mmHg | |
| Molecular Formula | C9H4F6N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Bis(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.567g/cm3 |
|---|---|
| Boiling Point | 270.1ºC at 760 mmHg |
| Molecular Formula | C9H4F6N2 |
| Molecular Weight | 254.13200 |
| Flash Point | 117.1ºC |
| Exact Mass | 254.02800 |
| PSA | 28.68000 |
| LogP | 3.60050 |
| Index of Refraction | 1.486 |
| InChIKey | BKFXAUQYNCJXIZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2nc(C(F)(F)F)[nH]c2c1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-Bis-(trifluormethyl)-benzimidazol |
| BENZIMIDAZOLE,2,5-BIS(TRIFLUOROMETHYL) |
| 2,5-bis-trifluoromethyl-1(3)H-benzimidazole |
| 2,5-Bis-trifluormethyl-1(3)H-benzimidazol |
| 2,5-bis(trifluoromethyl)-1H-benzo[d]imidazole |
| 2,5-Bis(trifluoromethyl)-1H-benzimidazole |
| 2,5-Bis(trifluoromethyl)benzimidazole |
| 2,5-ditrifluoromethylbenzimidazole |
| 2,5-bis-trifluoromethyl-1(3)H-benzoimidazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: Related upstream materials(CAS) of 2,6-Bis(trifluoromethyl)-1H-benzimidazole: 76-05-1;368-71-8;400-98-6. |
| Q: What is the English name of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: The English name of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is 2,6-Bis(trifluoromethyl)-1H-benzimidazole. |
| Q: What is the SMILES notation of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: SMILES notation of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is FC(F)(F)c1ccc2nc(C(F)(F)F)[nH]c2c1. |
| Q: What is the LogP of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: LogP of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is 3.60050. |
| Q: What is the InChIKey of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: InChIKey of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is BKFXAUQYNCJXIZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: Molecular weight of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is 254.13200. |
| Q: What English synonyms does 2,6-Bis(trifluoromethyl)-1H-benzimidazole have? |
| A: English synonyms of 2,6-Bis(trifluoromethyl)-1H-benzimidazole: 2,5-Bis-(trifluormethyl)-benzimidazol, BENZIMIDAZOLE,2,5-BIS(TRIFLUOROMETHYL), 2,5-bis-trifluoromethyl-1(3)H-benzimidazole, 2,5-Bis-trifluormethyl-1(3)H-benzimidazol, 2,5-bis(trifluoromethyl)-1H-benzo[d]imidazole, 2,5-Bis(trifluoromethyl)-1H-benzimidazole, 2,5-Bis(trifluoromethyl)benzimidazole, 2,5-ditrifluoromethylbenzimidazole, 2,5-bis-trifluoromethyl-1(3)H-benzoimidazole. |
| Q: What is the CAS number of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: CAS number of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is 399-69-9. |
| Q: What is the polar surface area (PSA) of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: Polar surface area (PSA) of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is 28.68000. |
| Q: What is the boiling point of 2,6-Bis(trifluoromethyl)-1H-benzimidazole? |
| A: Boiling point of 2,6-Bis(trifluoromethyl)-1H-benzimidazole is 270.1ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |