1,3-Butanedione,1-benzo[b]thien-2-yl-4,4,4-trifluoro structure
|
Common Name | 1,3-Butanedione,1-benzo[b]thien-2-yl-4,4,4-trifluoro | ||
|---|---|---|---|---|
| CAS Number | 399-80-4 | Molecular Weight | 272.24300 | |
| Density | 1.424g/cm3 | Boiling Point | 351ºC at 760 mmHg | |
| Molecular Formula | C12H7F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.1ºC | |
| Name | 1-(1-benzothiophen-2-yl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 351ºC at 760 mmHg |
| Molecular Formula | C12H7F3O2S |
| Molecular Weight | 272.24300 |
| Flash Point | 166.1ºC |
| Exact Mass | 272.01200 |
| PSA | 62.38000 |
| LogP | 3.60550 |
| Index of Refraction | 1.565 |
| InChIKey | UGWUCJYFRPNSHU-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1cc2ccccc2s1 |
|
~%
1,3-Butanedione... CAS#:399-80-4 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-(3,4-methylenedioxyphenyl)-pentan-1-ol |
| 1-(3,4-methylenedioxyphenyl)pentanol |
| 1-Benzo[b]thiophen-2-yl-4,4,4-trifluor-butan-1,3-dion |
| 1-(3,4-methylenedioxyphenyl)-n-pentanol |
| 1-benzo[1,3]dioxol-5-yl-pentan-1-ol |
| 1-(1,3-benzodioxol-5-yl)-1-pentanol |
| 1-benzo[b]thiophen-2-yl-4,4,4-trifluoro-butane-1,3-dione |