1-(5-CHLORO-2-METHOXY-PHENYL)-PYRROLE-2,5-DIONE structure
|
Common Name | 1-(5-CHLORO-2-METHOXY-PHENYL)-PYRROLE-2,5-DIONE | ||
|---|---|---|---|---|
| CAS Number | 39900-81-7 | Molecular Weight | 237.63900 | |
| Density | 1.429g/cm3 | Boiling Point | 390ºC at 760mmHg | |
| Molecular Formula | C11H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | 1-(5-chloro-2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 390ºC at 760mmHg |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.63900 |
| Flash Point | 189.6ºC |
| Exact Mass | 237.01900 |
| PSA | 46.61000 |
| LogP | 1.84300 |
| Index of Refraction | 1.613 |
| InChIKey | KRYUCWYKHXDVIC-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1N1C(=O)C=CC1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(5-chloro-2-methoxyphenyl)-1H-pyrrole-2,5-dione |
| 1-(5-Chloro-2-methoxy-phenyl)-pyrrole-2,5-dione |
| N-(5-Chlor-2-methoxy-phenyl)-maleinimid |