N6-Benzoyl-2',3'-isopropylideneadenosine structure
|
Common Name | N6-Benzoyl-2',3'-isopropylideneadenosine | ||
|---|---|---|---|---|
| CAS Number | 39947-04-1 | Molecular Weight | 411.41 | |
| Density | 1.58±0.1 g/cm3(Predicted) | Boiling Point | N/A | |
| Molecular Formula | C20H21N5O5 | Melting Point | 144-146 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of N6-Benzoyl-2',3'-isopropylideneadenosineN6-Benzoyl-2',3'-isopropylidene adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | N-6-benzoyl-2',3'-O-isopropylideneadenosine |
|---|---|
| Synonym | More Synonyms |
| Description | N6-Benzoyl-2',3'-isopropylidene adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.58±0.1 g/cm3(Predicted) |
|---|---|
| Melting Point | 144-146 °C |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.41 |
| Exact Mass | 411.15400 |
| PSA | 120.62000 |
| LogP | 1.56140 |
| InChIKey | LJKIYWGWKVYJHS-QEPJRFBGSA-N |
| SMILES | CC1(C)OC2C(CO)OC(n3cnc4c(NC(=O)c5ccccc5)ncnc43)C2O1 |
| Storage condition | 2-8℃ |
| N6-benzoyl-2',3'-isopropylidene adenosine |
| N-[9-((3aR,4R,6R,6aR)-6-Hydroxymethyl-2,2-dimethyl-tetrahydro-furo[3,4-d][1,3]dioxol-4-yl)-9H-purin-6-yl]-benzamide |
| N6-benzoyl-2',3'-O-isopropylideneadenosine |
| N6-benzoyl-2',3'-isopropylideneadenosine |
| 2',3'-O,O-isopropylidene-6-N-benzoyladenosine |
| N6-benzoyl-2′,3′-O-isopropylideneadenosine |
| N6-monobenzyl 2',3'-O-isopropylidene adenosine |