Aldophosphamide diethyl acetal structure
|
Common Name | Aldophosphamide diethyl acetal | ||
|---|---|---|---|---|
| CAS Number | 39947-94-9 | Molecular Weight | 351.20700 | |
| Density | 1.221g/cm3 | Boiling Point | 441.2ºC at 760 mmHg | |
| Molecular Formula | C11H25Cl2N2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.6ºC | |
| Name | Aldophosphamide diethyl acetal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 441.2ºC at 760 mmHg |
| Molecular Formula | C11H25Cl2N2O4P |
| Molecular Weight | 351.20700 |
| Flash Point | 220.6ºC |
| Exact Mass | 350.09300 |
| PSA | 83.83000 |
| LogP | 3.33890 |
| Index of Refraction | 1.482 |
| InChIKey | HAUWHFROJHPKIL-UHFFFAOYSA-N |
| SMILES | CCOC(CCOP(N)(=O)N(CCCl)CCCl)OCC |
|
~%
Aldophosphamide... CAS#:39947-94-9 |
| Literature: Takamizawa,A. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, p. 376 - 383 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O-(3,3-Diethoxypropyl)-N,N-bis(2-chloroethyl)phosphorodiamidate |
| o-(2-tetrahydropyranyloxymethyl)phenylmagnesium bromide |
| O-(3-(3-methoxyphenyl)-2-propynyl)hydroxylamine |
| Magnesium,bromo[2-[[(tetrahydro-2H-pyran-2-yl)oxy]methyl]phenyl] |
| O-(2-trifluoromethylphenyl)hydroxylamine |