[1-(dimethylaminomethyl)cyclobutyl]methyl 4-nitrobenzoate structure
|
Common Name | [1-(dimethylaminomethyl)cyclobutyl]methyl 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 39980-82-0 | Molecular Weight | 292.33000 | |
| Density | 1.188g/cm3 | Boiling Point | 408.5ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | [1-[(dimethylamino)methyl]cyclobutyl]methyl 4-nitrobenzoate |
|---|
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 408.5ºC at 760 mmHg |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33000 |
| Flash Point | 200.8ºC |
| Exact Mass | 292.14200 |
| PSA | 75.36000 |
| LogP | 3.00670 |
| Index of Refraction | 1.552 |
| InChIKey | WVCXZHNEVCHYPC-UHFFFAOYSA-N |
| SMILES | CN(C)CC1(COC(=O)c2ccc([N+](=O)[O-])cc2)CCC1 |
|
~%
[1-(dimethylami... CAS#:39980-82-0 |
| Literature: Newman; Broger; LaPidus; Tye Journal of medicinal chemistry, 1972 , vol. 15, # 10 p. 1003 - 1006 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |