N,N-diethyl-3,4-dimethyl-1-oxo-2,5-dihydro-1λ5-phosphol-1-amine structure
|
Common Name | N,N-diethyl-3,4-dimethyl-1-oxo-2,5-dihydro-1λ5-phosphol-1-amine | ||
|---|---|---|---|---|
| CAS Number | 39997-44-9 | Molecular Weight | 201.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20NOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethyl-3,4-dimethyl-1-oxo-2,5-dihydro-1λ5-phosphol-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H20NOP |
|---|---|
| Molecular Weight | 201.24600 |
| Exact Mass | 201.12800 |
| PSA | 30.12000 |
| LogP | 2.95630 |
| InChIKey | AMXXLFVWCSFFHL-UHFFFAOYSA-N |
| SMILES | CCN(CC)P1(=O)CC(C)=C(C)C1 |
|
~72%
N,N-diethyl-3,4... CAS#:39997-44-9 |
| Literature: Quin, Louis D.; Szewczyk, Jerzy Phosphorus and Sulfur and the Related Elements, 1984 , vol. 21, p. 161 - 170 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Oxo-1-diethylamino-3,4-dimethyl-3-phospholen |
| 1-(N,N-diethylamino)-3,4-dimethyl-3-phospholene-1-oxide |
| 1H-Phosphol-1-amine,N,N-diethyl-2,5-dihydro-3,4-dimethyl-,1-oxide |