N-(2-Aminophenyl)-3-(trifluoromethyl)benzamide structure
|
Common Name | N-(2-Aminophenyl)-3-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 400073-82-7 | Molecular Weight | 280.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-Aminophenyl)-3-(trifluoromethyl)benzamide |
|---|
| Molecular Formula | C14H11F3N2O |
|---|---|
| Molecular Weight | 280.24500 |
| Exact Mass | 280.08200 |
| PSA | 55.12000 |
| LogP | 4.19410 |
| InChIKey | GHMQDKBUBCXCIU-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1NC(=O)c1cccc(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
|
~66%
N-(2-Aminopheny... CAS#:400073-82-7 |
| Literature: Kakuta, Hiroki; Zheng, Xiaoxia; Oda, Hiroyuki; Harada, Shun; Sugimoto, Yukio; Sasaki, Kenji; Tai, Akihiro Journal of Medicinal Chemistry, 2008 , vol. 51, # 8 p. 2400 - 2411 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |