5-butyl-4-methyl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-3-oxido-1,3-thiazol-3-ium
Modify Date: 2024-09-15 18:32:49
![5-butyl-4-methyl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-3-oxido-1,3-thiazol-3-ium Structure](https://image.chemsrc.com/caspic/248/40019-77-0.png)
5-butyl-4-methyl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-3-oxido-1,3-thiazol-3-ium structure
|
Common Name | 5-butyl-4-methyl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-3-oxido-1,3-thiazol-3-ium | ||
|---|---|---|---|---|
| CAS Number | 40019-77-0 | Molecular Weight | 308.35300 | |
| Density | 1.31g/cm3 | Boiling Point | 483.8ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.4ºC | |
| Name | 5-butyl-4-methyl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-3-oxido-1,3-thiazol-3-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 483.8ºC at 760 mmHg |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.35300 |
| Flash Point | 246.4ºC |
| Exact Mass | 308.08300 |
| PSA | 112.66000 |
| LogP | 5.02240 |
| Index of Refraction | 1.612 |
| InChIKey | AXVDSQDWKOCWJL-VQHVLOKHSA-N |
| SMILES | CCCCc1sc(C=Cc2ccc([N+](=O)[O-])o2)[n+]([O-])c1C |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Thiazole,5-butyl-4-methyl-2-(2-(5-nitrofuryl)vinyl)-,3-oxide |
| 2-(5-Nitrofuryl-vinyl)-4-methyl-5-butylthiazol-N-oxyd |
| 5-Butyl-4-methyl-2-(2-(5-nitrofuryl)vinyl)thiazole 3-oxide |