pyridafol structure
|
Common Name | pyridafol | ||
|---|---|---|---|---|
| CAS Number | 40020-01-7 | Molecular Weight | 206.62800 | |
| Density | 1.35g/cm3 | Boiling Point | 315.3ºC at 760 mmHg | |
| Molecular Formula | C10H7ClN2O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 144.5ºC | |
| Name | pyridafol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 315.3ºC at 760 mmHg |
| Molecular Formula | C10H7ClN2O |
| Molecular Weight | 206.62800 |
| Flash Point | 144.5ºC |
| Exact Mass | 206.02500 |
| PSA | 46.01000 |
| LogP | 2.50260 |
| Index of Refraction | 1.641 |
| InChIKey | ZUSHSDOEVHPTCU-UHFFFAOYSA-N |
| SMILES | O=c1cc(Cl)[nH]nc1-c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridafol |
| Pyridafol [ISO] |
| 3-phenyl-4-hydroxy-6-chloropyridazine |
| 3-phenyl-4-hydroxy-6-chlorpyridazine |
| EINECS 254-752-1 |
| 6-chloro-3-phenyl-1H-pyridazin-4-one |
| 6-chloro-3-phenyl-4-pyridazinol |
| 6-Chloro-3-phenylpyridazin-4-ol |
| 3-Chloro-5-hydroxy-6-phenylpyridazine,6-Chloro-3-phenyl-4-pyridazinol |
| 6-chloro-3-phenylpyridazin-4-ol |
| CL 9673 |