2-nitro-1-benzofuran-5-ol structure
|
Common Name | 2-nitro-1-benzofuran-5-ol | ||
|---|---|---|---|---|
| CAS Number | 40024-32-6 | Molecular Weight | 179.13000 | |
| Density | 1.536g/cm3 | Boiling Point | 354.3ºC at 760 mmHg | |
| Molecular Formula | C8H5NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1ºC | |
| Name | 2-nitro-1-benzofuran-5-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.536g/cm3 |
|---|---|
| Boiling Point | 354.3ºC at 760 mmHg |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13000 |
| Flash Point | 168.1ºC |
| Exact Mass | 179.02200 |
| PSA | 79.19000 |
| LogP | 2.56980 |
| Index of Refraction | 1.694 |
| InChIKey | QKIGVICQJLBWQQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2cc(O)ccc2o1 |
|
~%
2-nitro-1-benzo... CAS#:40024-32-6 |
| Literature: Ohishi, Yoshitaka; Doi, Yoshio; Nakanishi, Teruo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 11 p. 4260 - 4270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-hydroxy-2-nitrobenzo<b>furan |
| 5-Hydroxy-2-nitro-benzofuran |
| 2-Nitrobenzofuran-5-ol |
| 5-Benzofuranol,2-nitro |
| 2-Nitro-5-hydroxybenzofuran |