iodomethane,1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine structure
|
Common Name | iodomethane,1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 40028-13-5 | Molecular Weight | 466.39900 | |
| Density | N/A | Boiling Point | 446.8ºC at 760 mmHg | |
| Molecular Formula | C22H31IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.9ºC | |
| Name | iodomethane,1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 446.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C22H31IN2O |
| Molecular Weight | 466.39900 |
| Flash Point | 124.9ºC |
| Exact Mass | 466.14800 |
| PSA | 15.71000 |
| LogP | 4.54350 |
| InChIKey | FMVFMRSBKWTVHX-UHFFFAOYSA-N |
| SMILES | CI.COc1ccc(C(CCc2ccccc2)N2CCN(C)CC2)cc1 |
| 1-[1-(4-methoxyphenyl)-3-phenylpropyl]-4-methylpiperazine-iodomethane(1:1) |
| 1-(1-(4-Methoxyphenyl)-3-phenylpropyl)-4-methylpiperazine compd. with iodomethane |
| Piperazine,1-(1-(4-methoxyphenyl)-3-phenylpropyl)-4-methyl-,compd. with iodomethane (1:1) |