1,4,3,5-Oxathiadiazine,2-methoxy-6-(4-methoxyphenyl)-, 4,4-dioxide structure
|
Common Name | 1,4,3,5-Oxathiadiazine,2-methoxy-6-(4-methoxyphenyl)-, 4,4-dioxide | ||
|---|---|---|---|---|
| CAS Number | 40028-45-3 | Molecular Weight | 270.26200 | |
| Density | 1.46g/cm3 | Boiling Point | 376.9ºC at 760mmHg | |
| Molecular Formula | C10H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | 2-methoxy-6-(4-methoxyphenyl)-1,4,3,5-oxathiadiazine 4,4-dioxide |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 376.9ºC at 760mmHg |
| Molecular Formula | C10H10N2O5S |
| Molecular Weight | 270.26200 |
| Flash Point | 181.7ºC |
| Exact Mass | 270.03100 |
| PSA | 94.93000 |
| LogP | 0.67120 |
| Index of Refraction | 1.602 |
| InChIKey | ZIGDZFHLSCHHKS-UHFFFAOYSA-N |
| SMILES | COC1=NS(=O)(=O)N=C(c2ccc(OC)cc2)O1 |
|
~%
1,4,3,5-Oxathia... CAS#:40028-45-3 |
| Literature: Burgess,E.M.; Williams,W.M. Journal of Organic Chemistry, 1973 , vol. 38, p. 1249 - 1250 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |