2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole
Modify Date: 2025-10-11 11:06:38
![2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole Structure](https://www.chemsrc.com/extcaspic/005/40045-52-1.png)
2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole structure
|
Common Name | 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 40045-52-1 | Molecular Weight | 306.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H6N4O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H6N4O3S2 |
|---|---|
| Molecular Weight | 306.3 |
| InChIKey | HTVQOBHKARTUEY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Sc2nnc(-c3ccccc3)o2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole? |
| A: CAS number of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole is 40045-52-1. |
| Q: What is the InChIKey of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole? |
| A: InChIKey of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole is HTVQOBHKARTUEY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole? |
| A: Molecular weight of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole is 306.3. |
| Q: What is the Chinese name of 40045-52-1? |
| A: Chinese name of 40045-52-1 is 40045-52-1. |
| Q: What is the molecular formula of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole? |
| A: Molecular formula of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole is C11H6N4O3S2. |
| Q: What is the English name of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole? |
| A: The English name of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole is 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole. |
| Q: What is the SMILES notation of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole? |
| A: SMILES notation of 2-[(5-Nitro-2-thiazolyl)thio]-5-phenyl-1,3,4-oxadiazole is O=[N+]([O-])c1cnc(Sc2nnc(-c3ccccc3)o2)s1. |