(3-(Benzyloxy)benzyl)hydrazine hydrochloride structure
|
Common Name | (3-(Benzyloxy)benzyl)hydrazine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 40051-69-2 | Molecular Weight | 264.75100 | |
| Density | N/A | Boiling Point | 448.2ºC at 760 mmHg | |
| Molecular Formula | C14H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9ºC | |
| Name | (3-phenylmethoxyphenyl)methylhydrazine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 448.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.75100 |
| Flash Point | 224.9ºC |
| Exact Mass | 264.10300 |
| PSA | 47.28000 |
| LogP | 4.12210 |
| InChIKey | PRGGCLNHEAROAN-UHFFFAOYSA-N |
| SMILES | Cl.NNCc1cccc(OCc2ccccc2)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (3-phenylmethoxyphenyl)methyldiazane hydrochloride |
| (3-phenylmethoxyphenyl)methylhydrazine hydrochloride |
| (3-benzyloxy-benzyl)-hydrazine hydrochloride |
| (3-BENZYLOXY-BENZYL)-HYDRAZINE HCL |