N-(2-morpholin-4-ylethyl)-6-phenyl-pyridazin-3-amine structure
|
Common Name | N-(2-morpholin-4-ylethyl)-6-phenyl-pyridazin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 40064-52-6 | Molecular Weight | 284.35600 | |
| Density | 1.176g/cm3 | Boiling Point | 533.7ºC at 760 mmHg | |
| Molecular Formula | C16H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.6ºC | |
| Name | N-(2-morpholin-4-ylethyl)-6-phenylpyridazin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 533.7ºC at 760 mmHg |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.35600 |
| Flash Point | 276.6ºC |
| Exact Mass | 284.16400 |
| PSA | 50.28000 |
| LogP | 1.89860 |
| Index of Refraction | 1.601 |
| InChIKey | GWGMHVNYPVDVIJ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc(NCCN3CCOCC3)nn2)cc1 |
| HS Code | 2934999090 |
|---|
|
~79%
N-(2-morpholin-... CAS#:40064-52-6 |
| Literature: Contreras, Jean-Marie; Rival, Yveline M.; Chayer, Said; Bourguignon, Jean-Jacques; Wermuth, Camille G. Journal of Medicinal Chemistry, 1999 , vol. 42, # 4 p. 730 - 741 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-<2-(morpholin-4-yl)ethylamino>-6-phenylpyridazine |
| (2-morpholin-4-yl-ethyl)-(6-phenyl-pyridazin-3-yl)-amine |
| demethylminaprine |
| N-(2-MORPHOLIN-4-YLETHYL)-6-PHENYL-PYRIDAZIN-3-AMINE |
| 4-morpholineethanamine,n-(6-phenyl-3-pyridazinyl) |