7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione
Modify Date: 2025-10-11 16:34:40
![7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Structure](https://image.chemsrc.com/caspic/064/40075-79-4.png)
7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione structure
|
Common Name | 7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 40075-79-4 | Molecular Weight | 239.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H21N3O2 |
|---|---|
| Molecular Weight | 239.31400 |
| Exact Mass | 239.16300 |
| PSA | 68.42000 |
| LogP | 0.70120 |
| InChIKey | YDIBXNDCNQIVFJ-UHFFFAOYSA-N |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)NC(=O)NC2=O |
|
~%
7,7,8,9,9-penta... CAS#:40075-79-4 |
| Literature: Mailey; Day Journal of Organic Chemistry, 1957 , vol. 22, p. 1061,1065 |
|
~%
7,7,8,9,9-penta... CAS#:40075-79-4 |
| Literature: Mailey; Day Journal of Organic Chemistry, 1957 , vol. 22, p. 1061,1065 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7,7,8,9,9-pentamethyl-1,3,8-triaza-spiro[4.5]decane-2,4-dione |
| 1,3,8-Triazaspiro[4.5]decane-2,4-dione,7,7,8,9,9-pentamethyl |
| 1,3,8-triaza-7,7,8,9,9-pentamethyl-spiro[4.5]decane-2,4-dione |
| 7,7,8,9,9-Pentamethyl-1,3,8-triaza-spiro[4.5]decan-2,4-dion |