N-(4-fluoro-2-methylphenyl)benzamide
Modify Date: 2026-03-02 16:19:13
N-(4-fluoro-2-methylphenyl)benzamide structure
|
Common Name | N-(4-fluoro-2-methylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 401-25-2 | Molecular Weight | 229.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-fluoro-2-methylphenyl)benzamide |
|---|
| Molecular Formula | C14H12FNO |
|---|---|
| Molecular Weight | 229.25 |
| InChIKey | WLIIHTAATITOQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)NC(=O)C2=CC=CC=C2 |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 5, Current Page 1 of 1
1