IQDMA structure
|
Common Name | IQDMA | ||
|---|---|---|---|---|
| CAS Number | 401463-02-3 | Molecular Weight | 304.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IQDMAA cell-permeable, small molecule inhibitor of the transcription factor STAT5 that exhibits anticancer activity and inhibits the growth of A549, HL-60 and K562 cells with IC50 of 8, 5 and 8 uM, respectively.. |
| Name | N'-(11H-indolo[3,2-c]quinolin-6-yl)-N,N-dimethylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20N4 |
|---|---|
| Molecular Weight | 304.38900 |
| Exact Mass | 304.16900 |
| PSA | 43.95000 |
| LogP | 3.91580 |
| InChIKey | UROLFQZUYMCOHV-UHFFFAOYSA-N |
| SMILES | CN(C)CCNc1nc2ccccc2c2[nH]c3ccccc3c12 |
| N-(2-(dimethylamino)ethyl)-(11H-indolo[3,2-c]quinolin-6-yl)amine |
| IQDMA |