1,3,5-tripropyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione structure
|
Common Name | 1,3,5-tripropyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione | ||
|---|---|---|---|---|
| CAS Number | 4015-16-1 | Molecular Weight | 255.31300 | |
| Density | 1.103g/cm3 | Boiling Point | 361.5ºC at 760 mmHg | |
| Molecular Formula | C12H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.4ºC | |
| Name | 1,3,5-tripropyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 361.5ºC at 760 mmHg |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.31300 |
| Flash Point | 147.4ºC |
| Exact Mass | 255.15800 |
| PSA | 66.00000 |
| LogP | 0.40170 |
| Vapour Pressure | 2.06E-05mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | OFHWSHGIZXHMJP-UHFFFAOYSA-N |
| SMILES | CCCn1c(=O)n(CCC)c(=O)n(CCC)c1=O |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3,5-tripropyl-[1,3,5]triazinane-2,4,6-trione |
| tris(n-propyl) isocyanurate |
| N,N',N''-tris-(propyl) isocyanurate |
| tri-n-propyl isocyanurate |
| tripropyl isocyanurate |
| 1,3,5-Tripropyl-1,3,5-triazin-2,4,6-trion,1,2,3-Tripropyl-isocyanursaeure |
| 1,3,5-tripropyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione |
| EINECS 223-668-7 |