tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate
tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 401565-86-4 | Molecular Weight | 381.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H25BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H25BrN2O2 |
|---|---|
| Molecular Weight | 381.30700 |
| Exact Mass | 380.11000 |
| PSA | 32.78000 |
| LogP | 4.21400 |
| InChIKey | MGCVDSKPCGERMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCc3cc(Br)ccc32)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Piperidinecarboxylicacid,4-(5-bromo-2,3-dihydro-1H-indol-1-yl)-,1,1-dimethylethyl ester |
| tert-butyl 4-(5-bromoindolin-1-yl)piperidine-1-carboxylate |
| 1,1-dimethylethyl 4-(5-bromo-2,3-dihydro-1H-indol-1-yl)-1-piperidinecarboxylate |
| TERT-BUTYL 4-(5-BROMO-2,3-DIHYDRO-1H-INDOL-1-YL)PIPERIDINE-1-CARBOXYLATE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate have? |
| A: English synonyms of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate: 1-Piperidinecarboxylicacid,4-(5-bromo-2,3-dihydro-1H-indol-1-yl)-,1,1-dimethylethyl ester, tert-butyl 4-(5-bromoindolin-1-yl)piperidine-1-carboxylate, 1,1-dimethylethyl 4-(5-bromo-2,3-dihydro-1H-indol-1-yl)-1-piperidinecarboxylate, TERT-BUTYL 4-(5-BROMO-2,3-DIHYDRO-1H-INDOL-1-YL)PIPERIDINE-1-CARBOXYLATE. |
| Q: What is the Chinese name of 401565-86-4? |
| A: Chinese name of 401565-86-4 is 401565-86-4. |
| Q: What is the InChIKey of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: InChIKey of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate is MGCVDSKPCGERMO-UHFFFAOYSA-N. |
| Q: What is the LogP of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: LogP of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate is 4.21400. |
| Q: What is the CAS number of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: CAS number of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate is 401565-86-4. |
| Q: What is the molecular formula of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: Molecular formula of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate is C18H25BrN2O2. |
| Q: What are the upstream materials of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: Related upstream materials(CAS) of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate: 400828-91-3;22190-33-6;79099-07-3;496-15-1. |
| Q: What is the English name of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: The English name of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate is tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate. |
| Q: What is the molecular weight of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: Molecular weight of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate is 381.30700. |
| Q: What is the SMILES notation of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate? |
| A: SMILES notation of tert-butyl 4-(5-bromo-2,3-dihydroindol-1-yl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(N2CCc3cc(Br)ccc32)CC1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |