2-chloro-N-(chloromethyl)-N-(2,6-diethylphenyl)acetamide structure
|
Common Name | 2-chloro-N-(chloromethyl)-N-(2,6-diethylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 40164-69-0 | Molecular Weight | 274.18600 | |
| Density | 1.194 g/cm3 | Boiling Point | 410.2ºC at 760 mmHg | |
| Molecular Formula | C13H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | 2-chloro-N-(chloromethyl)-N-(2,6-diethylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194 g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760 mmHg |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.18600 |
| Flash Point | 201.9ºC |
| Exact Mass | 273.06900 |
| PSA | 20.31000 |
| LogP | 3.57950 |
| Index of Refraction | 1.558 |
| InChIKey | PDQMMZXYWKOZHY-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1N(CCl)C(=O)CCl |
| HS Code | 2924299090 |
|---|
|
~%
2-chloro-N-(chl... CAS#:40164-69-0 |
| Literature: PPG Industries, Inc. Patent: US4319917 A1, 1982 ; |
|
~%
2-chloro-N-(chl... CAS#:40164-69-0 |
| Literature: Velsicol Chemical Corporation Patent: US3976471 A1, 1976 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2',6'-diethyl-N-chloromethyl-2-chloroacetanilide |
| EINECS 254-817-4 |