2-methylsulfanylisoindole-1,3-dione structure
|
Common Name | 2-methylsulfanylisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 40167-20-2 | Molecular Weight | 193.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7NO2S | Melting Point | 176-180ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylsulfanylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 176-180ºC(lit.) |
|---|---|
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.22200 |
| Exact Mass | 193.02000 |
| PSA | 62.68000 |
| LogP | 1.49850 |
| HS Code | 2930909090 |
|---|
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methylsulfanyl-1H-isoindole-1,3(2H)-dione |
| N-methylthiophthalimide |
| 1H-Isoindole-1,3(2H)-dione,2-(methylthio) |
| I10-1535 |
| S-methyl-N-thiophthalimide |
| methylthiophthalimide |
| 2-(methylthio)isoindoline-1,3-dione |
| InChI=1/C9H7NO2S/c1-13-10-8(11)6-4-2-3-5-7(6)9(10)12/h2-5H,1H |