2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[(4-methylphenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylate structure
|
Common Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[(4-methylphenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 401813-50-1 | Molecular Weight | 423.50100 | |
| Density | 1.188g/cm3 | Boiling Point | 569.4ºC at 760 mmHg | |
| Molecular Formula | C25H29NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 298.1ºC | |
| Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[(4-methylphenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 569.4ºC at 760 mmHg |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.50100 |
| Flash Point | 298.1ºC |
| Exact Mass | 423.20500 |
| PSA | 72.91000 |
| LogP | 4.37100 |
| Index of Refraction | 1.566 |
| InChIKey | VKNAYMXEGGFDHX-RTWAWAEBSA-N |
| SMILES | Cc1ccc(CC2CC(C(=O)OCc3ccccc3)N(C(=O)OC(C)(C)C)C2=O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Benzyl (2S,4R)-1-Boc-4-(4-methylbenzyl)-5-oxo-2-pyrrolidinecarboxylate |
| (4R)-Boc-4-(4-methylbenzyl)-L-pyroglutamic acid benzyl ester |
| (4R)-Boc-4-(4-methylbenzyl)-Pyr-OBzl |