2,2',3,3',4,5',6,6'-PCB structure
|
Common Name | 2,2',3,3',4,5',6,6'-PCB | ||
|---|---|---|---|---|
| CAS Number | 40186-71-8 | Molecular Weight | 429.768 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 419.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H2Cl8 | Melting Point | 150.67°C (estimate) | |
| MSDS | N/A | Flash Point | 204.0±24.7 °C | |
| Name | 2,2',3,3',4,5',6,6'-Octachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.2±40.0 °C at 760 mmHg |
| Melting Point | 150.67°C (estimate) |
| Molecular Formula | C12H2Cl8 |
| Molecular Weight | 429.768 |
| Flash Point | 204.0±24.7 °C |
| Exact Mass | 425.766479 |
| LogP | 7.50 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | LJQOBQLZTUSEJA-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(-c2c(Cl)c(Cl)cc(Cl)c2Cl)c(Cl)c1Cl |
| HS Code | 2903999090 |
|---|
|
~%
2,2',3,3',4,5',... CAS#:40186-71-8 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2',3,3',4,5',6,6'-Octachlorobiphenyl |
| 2,2',3,3',4,5',6,6'-Octachloro-1,1'-biphenyl |
| 1,2,3,5-tetrachloro-4-(2,3,5,6-tetrachlorophenyl)benzene |
| 2,2',3,3',4,5',6,6'-PCB |