5-Chloro-3-(4-chlorophenyl)-4'-chlorosalicylanilide structure
|
Common Name | 5-Chloro-3-(4-chlorophenyl)-4'-chlorosalicylanilide | ||
|---|---|---|---|---|
| CAS Number | 4019-40-3 | Molecular Weight | 392.66300 | |
| Density | 1.465g/cm3 | Boiling Point | 487.9ºC at 760 mmHg | |
| Molecular Formula | C19H12Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | 5-chloro-N,3-bis(4-chlorophenyl)-2-hydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 487.9ºC at 760 mmHg |
| Molecular Formula | C19H12Cl3NO2 |
| Molecular Weight | 392.66300 |
| Flash Point | 248.9ºC |
| Exact Mass | 390.99300 |
| PSA | 49.33000 |
| LogP | 6.34470 |
| Vapour Pressure | 3.81E-10mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | ASSOGKHCUUVDFJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(Cl)cc(-c2ccc(Cl)cc2)c1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| OM-1463 |
| ENT 27,139 |
| 5-Chloro-3-(4-chlorophenyl)-4'-chlorosalicylanilide |
| Salicylanilide,3-(4-chlorophenyl)-4',5-dichloro |
| 3-BIPHENYLCARBOXANILIDE,4',4'',5-TRICHLORO-2-HYDROXY |