2,6-diiodo-4-[(2-methyl-1-benzofuran-3-yl)methyl]phenol structure
|
Common Name | 2,6-diiodo-4-[(2-methyl-1-benzofuran-3-yl)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 401917-61-1 | Molecular Weight | 490.07400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12I2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-diiodo-4-[(2-methyl-1-benzofuran-3-yl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12I2O2 |
|---|---|
| Molecular Weight | 490.07400 |
| Exact Mass | 489.89300 |
| PSA | 33.37000 |
| LogP | 5.24680 |
| InChIKey | ZHAMIXFCKGNYMT-UHFFFAOYSA-N |
| SMILES | Cc1oc2ccccc2c1Cc1cc(I)c(O)c(I)c1 |
|
~%
2,6-diiodo-4-[(... CAS#:401917-61-1 |
| Literature: Carlsson, Bo; Singh; Temciuc, Marcel; Nilsson, Stefan; Li, Yi-Lin; Mellin, Charlotta; Malm, Johan Journal of Medicinal Chemistry, 2002 , vol. 45, # 3 p. 623 - 630 |
|
~%
2,6-diiodo-4-[(... CAS#:401917-61-1 |
| Literature: Carlsson, Bo; Singh; Temciuc, Marcel; Nilsson, Stefan; Li, Yi-Lin; Mellin, Charlotta; Malm, Johan Journal of Medicinal Chemistry, 2002 , vol. 45, # 3 p. 623 - 630 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-3-(3,5-diiodo-4-hydroxybenzyl)benzofuran |
| 3-[(3,5-DIIODO-4-HYDROXYPHENYL)METHYL]-2-METHYLBENZOFURAN |