N-(4-methoxyphenyl)-N'-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]propanediamide
Modify Date: 2025-08-20 21:16:33
![N-(4-methoxyphenyl)-N'-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]propanediamide Structure](https://image.chemsrc.com/caspic/104/40256-99-3.png)
N-(4-methoxyphenyl)-N'-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]propanediamide structure
|
Common Name | N-(4-methoxyphenyl)-N'-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]propanediamide | ||
|---|---|---|---|---|
| CAS Number | 40256-99-3 | Molecular Weight | 394.38800 | |
| Density | 1.26g/cm3 | Boiling Point | 605.694ºC at 760 mmHg | |
| Molecular Formula | C20H21F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.112ºC | |
| Name | N-(4-methoxyphenyl)-N'-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]propanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 605.694ºC at 760 mmHg |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.38800 |
| Flash Point | 320.112ºC |
| Exact Mass | 394.15000 |
| PSA | 74.41000 |
| LogP | 5.27980 |
| Index of Refraction | 1.544 |
| InChIKey | SKWBJBJQEUEFCY-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(OCC(=O)NC(C)Cc2cccc(C(F)(F)F)c2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| unii-0jjt8mq49s |