Deacetylcinobufagin structure
|
Common Name | Deacetylcinobufagin | ||
|---|---|---|---|---|
| CAS Number | 4026-95-3 | Molecular Weight | 400.508 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 601.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H32O5 | Melting Point | 278-280ºC | |
| MSDS | N/A | Flash Point | 208.1±25.0 °C | |
Use of DeacetylcinobufaginDesacetylcinobufagin is a natural compound used for microbial transformation. |
| Name | Cinobufagin, deacetyl |
|---|---|
| Synonym | More Synonyms |
| Description | Desacetylcinobufagin is a natural compound used for microbial transformation. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 601.9±55.0 °C at 760 mmHg |
| Melting Point | 278-280ºC |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.508 |
| Flash Point | 208.1±25.0 °C |
| Exact Mass | 400.224976 |
| PSA | 83.20000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | IXZHDDUFQVXHIL-RWRAYJPQSA-N |
| SMILES | CC12CCC(O)CC1CCC1C2CCC2(C)C(c3ccc(=O)oc3)C(O)C3OC132 |
| Storage condition | -20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
Name: Inhibitory activity against the primary liver carcinoma (PLC) cell line PLC/PRF/5
Source: ChEMBL
Target: N/A
External Id: CHEMBL763907
|
|
Name: Retention time in Sprague-Dawley rat liver microsomes treated with 100 uM cinobufagin...
Source: ChEMBL
Target: Liver microsome
External Id: CHEMBL3533434
|
|
Name: Inhibitory activity against colchicine resistant parent primary liver carcinoma (PLC)...
Source: ChEMBL
Target: N/A
External Id: CHEMBL763906
|
|
Name: Cytotoxicity against human HL60 cells after 72 hrs by MTT assay
Source: ChEMBL
Target: HL-60
External Id: CHEMBL943438
|
|
Name: Cytotoxicity against human KB cells after 72 hrs by MTT assay
Source: ChEMBL
Target: KB
External Id: CHEMBL943437
|
|
Name: Cytotoxicity against mouse MH60 cells after 72 hrs by MTT assay
Source: ChEMBL
Target: MH60
External Id: CHEMBL943439
|
| Desacetylcinobufagin |
| (3β,5β,15β,16β)-3,16-Dihydroxy-14,15-epoxybufa-20,22-dienolide |
| Deacetylcinobufagin |
| 16-deacetylcinobufagin |
| Deacetylcinobufagine |