3-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]propanoic acid structure
|
Common Name | 3-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 40266-03-3 | Molecular Weight | 350.35000 | |
| Density | 1.552g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-oxo-4-[4-(pyrimidin-2-ylsulfamoyl)anilino]butanoic acid |
|---|
| Density | 1.552g/cm3 |
|---|---|
| Molecular Formula | C14H14N4O5S |
| Molecular Weight | 350.35000 |
| Exact Mass | 350.06800 |
| PSA | 146.73000 |
| LogP | 2.30750 |
| InChIKey | YSWMPGMFKSDCDV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
|
~%
3-[[4-(pyrimidi... CAS#:40266-03-3 |
| Literature: Schering A.G. Patent: DE909342 , 1941 ; Full Text Show Details Moore; Miller Journal of the American Chemical Society, 1942 , vol. 64, p. 1572,1573, 1574 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |