N,N'-bis(9,10-dihydro-9,10-dioxo-1-anthryl)phthaldiamide structure
|
Common Name | N,N'-bis(9,10-dihydro-9,10-dioxo-1-anthryl)phthaldiamide | ||
|---|---|---|---|---|
| CAS Number | 4028-94-8 | Molecular Weight | 576.55400 | |
| Density | 1.491g/cm3 | Boiling Point | 715.9ºC at 760mmHg | |
| Molecular Formula | C36H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4ºC | |
| Name | 1-N,2-N-bis(9,10-dioxoanthracen-1-yl)benzene-1,2-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.491g/cm3 |
|---|---|
| Boiling Point | 715.9ºC at 760mmHg |
| Molecular Formula | C36H20N2O6 |
| Molecular Weight | 576.55400 |
| Flash Point | 187.4ºC |
| Exact Mass | 576.13200 |
| PSA | 133.46000 |
| LogP | 6.51000 |
| Vapour Pressure | 2.4E-20mmHg at 25°C |
| Index of Refraction | 1.767 |
| InChIKey | WMFOCQJARALVQT-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2c1C(=O)c1ccccc1C2=O)c1ccccc1C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2924299090 |
|---|
|
~%
N,N'-bis(9,10-d... CAS#:4028-94-8 |
| Literature: Bayer and Co. Patent: DE216980 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| helio echtgelb E3R |
| N,N'-Bis(9,10-dihydro-9,10-dioxo-1-anthryl)phthaldiamide |
| N,N'-bis-(9,10-dioxo-9,10-dihydro-[1]anthryl)-phthalamide |
| N.N'-Di-(anthrachinonyl-(1))-phthalamid |
| 1,2-Benzenedicarboxamide,N,N'-bis(9,10-dihydro-9,10-dioxo-1-anthracenyl) |
| pigment yellow 99 |
| EINECS 223-710-4 |