3-Methylamino-1,2-diphenyl-propan-1-one; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 3-Methylamino-1,2-diphenyl-propan-1-one; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 40281-12-7 | Molecular Weight | 355.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methylamino-1,2-diphenyl-propan-1-one; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C20H21NO5 |
|---|---|
| Molecular Weight | 355.38400 |
| Exact Mass | 355.14200 |
| PSA | 103.70000 |
| LogP | 2.97520 |
| InChIKey | XVVRVNIDUKODKO-WLHGVMLRSA-N |
| SMILES | CNCC(C(=O)c1ccccc1)c1ccccc1.O=C(O)C=CC(=O)O |