2-chloro-N-[(3,5-dimethyl-1-adamantyl)methyl]ethanimidamide structure
|
Common Name | 2-chloro-N-[(3,5-dimethyl-1-adamantyl)methyl]ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 40284-41-1 | Molecular Weight | 305.28600 | |
| Density | 1.25g/cm3 | Boiling Point | 357.1ºC at 760 mmHg | |
| Molecular Formula | C15H26Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 2-chloro-N'-[(3,5-dimethyl-1-adamantyl)methyl]ethanimidamide,hydrochloride |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 357.1ºC at 760 mmHg |
| Molecular Formula | C15H26Cl2N2 |
| Molecular Weight | 305.28600 |
| Flash Point | 169.8ºC |
| Exact Mass | 304.14700 |
| PSA | 35.88000 |
| LogP | 5.08130 |
| Index of Refraction | 1.617 |
| InChIKey | KGPSDSSOUUEOIH-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C)(C1)CC(CN=C(N)CCl)(C3)C2.Cl |
|
~%
2-chloro-N-[(3,... CAS#:40284-41-1 |
| Literature: Abdelaal, Salma; Bauer, Ludwig Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 1849 - 1856 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |