hydrochloride of methyl ester of L-phenylalanyl-L-methionine structure
|
Common Name | hydrochloride of methyl ester of L-phenylalanyl-L-methionine | ||
|---|---|---|---|---|
| CAS Number | 40290-65-1 | Molecular Weight | 346.87300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hydrochloride of methyl ester of L-phenylalanyl-L-methionine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23ClN2O3S |
|---|---|
| Molecular Weight | 346.87300 |
| Exact Mass | 346.11200 |
| PSA | 106.72000 |
| LogP | 2.86050 |
| InChIKey | SRRCXLSREJKBQS-QNTKWALQSA-N |
| SMILES | COC(=O)C(CCSC)NC(=O)C(N)Cc1ccccc1.Cl |
| NH2-Phe-Met-OMe*HCl |
| Phe-Met-OCH3*HCl |
| (S)-2-((S)-2-Amino-3-phenyl-propionylamino)-4-methylsulfanyl-butyric acid methyl ester |
| hydrochloride |
| L-Phenylalanyl-L-methionin-methylester-hydrochlorid |
| phenylalanylmethionine methyl ester hydrochloride |
| H-Phe-Met-OMe*HCl |
| L-phenylalanyl-L-methionine methyl ester hydrochloride |