N,N-dimethyl-4-[[4-(phenylazo)phenyl]azo]aniline structure
|
Common Name | N,N-dimethyl-4-[[4-(phenylazo)phenyl]azo]aniline | ||
|---|---|---|---|---|
| CAS Number | 40292-01-1 | Molecular Weight | 329.39800 | |
| Density | 1.1g/cm3 | Boiling Point | 512.7ºC at 760 mmHg | |
| Molecular Formula | C20H19N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.9ºC | |
| Name | N,N-dimethyl-4-[(4-phenyldiazenylphenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 512.7ºC at 760 mmHg |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.39800 |
| Flash Point | 263.9ºC |
| Exact Mass | 329.16400 |
| PSA | 52.68000 |
| LogP | 6.58340 |
| Index of Refraction | 1.609 |
| InChIKey | IQDOOYRFBZVZJF-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2ccc(N=Nc3ccccc3)cc2)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
N,N-dimethyl-4-... CAS#:40292-01-1 |
| Literature: Hewitt; Thole Journal of the Chemical Society, 1909 , vol. 95, p. 1396 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzol-(1 azo 1)-benzol-(4 azo 4 )-(N.N-dimethyl-anilin) |
| EINECS 254-872-4 |
| 4'-Benzolazo-4-dimethylamino-azobenzol |
| N,N-Dimethyl-4-((4-(phenylazo)phenyl)azo)aniline |
| 4-Phenylazo-1-(4-dimethylamino-phenylazo)-benzol |