(4-aminophenyl)-(4-propan-2-ylphenyl)methanone structure
|
Common Name | (4-aminophenyl)-(4-propan-2-ylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 40292-22-6 | Molecular Weight | 239.31200 | |
| Density | 1.088g/cm3 | Boiling Point | 402ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
| Name | (4-aminophenyl)-(4-propan-2-ylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 402ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 196.9ºC |
| Exact Mass | 239.13100 |
| PSA | 43.09000 |
| LogP | 4.20440 |
| Index of Refraction | 1.592 |
| InChIKey | LOWKEYACSTXUQV-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C(=O)c2ccc(N)cc2)cc1 |
| HS Code | 2922399090 |
|---|
|
~55%
(4-aminophenyl)... CAS#:40292-22-6 |
| Literature: Carmellino, Maria L.; Pagani, Giuseppe; Pregnolato, Massimo; Terreni, Marco; Caprioli, Vincenzo; Zani, Franca Pesticide Science, 1995 , vol. 45, # 3 p. 227 - 236 |
|
~%
(4-aminophenyl)... CAS#:40292-22-6 |
| Literature: Carmellino, Maria L.; Pagani, Giuseppe; Pregnolato, Massimo; Terreni, Marco; Caprioli, Vincenzo; Zani, Franca Pesticide Science, 1995 , vol. 45, # 3 p. 227 - 236 |
|
~%
(4-aminophenyl)... CAS#:40292-22-6 |
| Literature: Carmellino, Maria L.; Pagani, Giuseppe; Pregnolato, Massimo; Terreni, Marco; Caprioli, Vincenzo; Zani, Franca Pesticide Science, 1995 , vol. 45, # 3 p. 227 - 236 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 254-874-5 |
| 4-Amino-4'-isopropylbenzophenone |
| p-Amino-p'-isopropylbenzophenon |
| 4-isopropyl-4'-aminobenzophenone |
| (4-aminophenyl)(4-isopropylphenyl)methanone |