Acetamide, 2-(4-chloro-2-methylphenoxy)-N-(3-(trifluoromethyl)phenyl)- (9CI) structure
|
Common Name | Acetamide, 2-(4-chloro-2-methylphenoxy)-N-(3-(trifluoromethyl)phenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 403-97-4 | Molecular Weight | 343.72800 | |
| Density | 1.36g/cm3 | Boiling Point | 471.3ºC at 760 mmHg | |
| Molecular Formula | C16H13ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.8ºC | |
| Name | 2-(4-chloro-2-methylphenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 471.3ºC at 760 mmHg |
| Molecular Formula | C16H13ClF3NO2 |
| Molecular Weight | 343.72800 |
| Flash Point | 238.8ºC |
| Exact Mass | 343.05900 |
| PSA | 38.33000 |
| LogP | 4.75770 |
| Vapour Pressure | 4.7E-09mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | PXOAPXKYVHUJCO-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
|
~%
Acetamide, 2-(4... CAS#:403-97-4 |
| Literature: Newman; Fones; Renoll Journal of the American Chemical Society, 1947 , vol. 69, p. 718,721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |