2-MORPHOLINO-5-NITROANILINE structure
|
Common Name | 2-MORPHOLINO-5-NITROANILINE | ||
|---|---|---|---|---|
| CAS Number | 4031-79-2 | Molecular Weight | 223.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-morpholin-4-yl-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13N3O3 |
|---|---|
| Molecular Weight | 223.22900 |
| Exact Mass | 223.09600 |
| PSA | 84.31000 |
| LogP | 2.18300 |
| InChIKey | MONFCTPJGGZWCX-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| HS Code | 2934999090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2-morpholin-4-yl-5-nitro-aniline |
| 5-Nitro-2-morpholino-anilin |
| 2-Morpholino-5-nitro-anilin |
| 2-morpholino-5-nitroaniline |
| 2-morpholin-4-yl-5-nitrophenylamine |