1-amino-4-hydroxy-5,8-bis(methylamino)anthracene-9,10-dione structure
|
Common Name | 1-amino-4-hydroxy-5,8-bis(methylamino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 40317-69-9 | Molecular Weight | 297.30900 | |
| Density | 1.496g/cm3 | Boiling Point | 656.2ºC at 760mmHg | |
| Molecular Formula | C16H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.6ºC | |
| Name | 1-amino-4-hydroxy-5,8-bis(methylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.496g/cm3 |
|---|---|
| Boiling Point | 656.2ºC at 760mmHg |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.30900 |
| Flash Point | 350.6ºC |
| Exact Mass | 297.11100 |
| PSA | 104.45000 |
| LogP | 2.56040 |
| Index of Refraction | 1.788 |
| InChIKey | FOTVEZWKOYVUKP-UHFFFAOYSA-N |
| SMILES | CNc1ccc(NC)c2c1C(=O)c1c(N)ccc(O)c1C2=O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 254-881-3 |
| 1-Amino-4-hydroxy-5,8-bis-methylamino-anthrachinon |
| 9,10-Anthracenedione,1-amino-4-hydroxy-5,8-bis(methylamino) |
| 1-amino-4-hydroxy-5,8-bis-methylamino-anthraquinone |
| 1,4-Bis(methylamino)-5-amino-8-hydroxyanthraquinone |