3-methoxy-1-methyl-4-phenylquinolin-2-one structure
|
Common Name | 3-methoxy-1-methyl-4-phenylquinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 40357-47-9 | Molecular Weight | 265.30700 | |
| Density | 1.22g/cm3 | Boiling Point | 404.7ºC at 760 mmHg | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | 3-methoxy-1-methyl-4-phenylquinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 404.7ºC at 760 mmHg |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.30700 |
| Flash Point | 198.6ºC |
| Exact Mass | 265.11000 |
| PSA | 31.23000 |
| LogP | 3.21410 |
| Index of Refraction | 1.64 |
| InChIKey | WKAIBHQBQFURRQ-UHFFFAOYSA-N |
| SMILES | COc1c(-c2ccccc2)c2ccccc2n(C)c1=O |
| HS Code | 2933790090 |
|---|
|
~%
3-methoxy-1-met... CAS#:40357-47-9 |
| Literature: Austin; Meyers Journal of the Chemical Society, 1964 , p. 1197 Full Text Show Details Bracken et al. Biochemical Journal, 1954 , vol. 57, p. 587,594 |
|
~%
3-methoxy-1-met... CAS#:40357-47-9 |
| Literature: Bracken et al. Biochemical Journal, 1954 , vol. 57, p. 587,594 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| N,3-O-Dimethylviridicatin |
| 3-Methoxy-N-methyl-4-phenylcarbostyril |
| 3-methoxy-1-methyl-4-phenyl-1H-quinolin-2-one |
| 3-methoxy-1-methyl-4-phenyl-quinolin-2-one |
| O,N-Dimethyl-viridicatin |
| 3-Methoxy-1-methyl-4-phenylcarbostyril |
| 3-Methoxy-1-methyl-4-phenyl-1H-chinolin-2-on |
| 3-methoxy-1-methyl-4-phenylquinolin-2(1h)-one |